C15H26N6 — CID 80784794
4-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-6-N-propylpyrimidine-2,4,6-triamine (PubChem CID 80784794) has the molecular formula C15H26N6 and a molecular weight of 290.42 g/mol. Its IUPAC name is 4-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-6-N-propylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-6-N-propylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80784794 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 4-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-6-N-propylpyrimidine-2,4,6-triamine |
| SMILES | CCCNc1cc(NC2CCN3CCCCC23)nc(N)n1 |
| InChI | InChI=1S/C15H26N6/c1-2-7-17-13-10-14(20-15(16)19-13)18-11-6-9-21-8-4-3-5-12(11)21/h10-12H,2-9H2,1H3,(H4,16,17,18,19,20) |
| InChIKey | IIDSAICTGMCGKU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |