C14H21ClN4 — CID 80936085
N-(6-chloro-2-ethylpyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine (PubChem CID 80936085) has the molecular formula C14H21ClN4 and a molecular weight of 280.80 g/mol. Its IUPAC name is N-(6-chloro-2-ethylpyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine.
| Compound Name | N-(6-chloro-2-ethylpyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
|---|---|
| PubChem CID | 80936085 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-(6-chloro-2-ethylpyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
| SMILES | CCc1nc(Cl)cc(NC2CCN3CCCCC23)n1 |
| InChI | InChI=1S/C14H21ClN4/c1-2-13-17-12(15)9-14(18-13)16-10-6-8-19-7-4-3-5-11(10)19/h9-11H,2-8H2,1H3,(H,16,17,18) |
| InChIKey | QRSBYKNBNHAKNI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |