C13H19N3O2S — CID 80569926
2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 80569926) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 80569926 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(NC2CCN3CCCCC23)sc1C(=O)O |
| InChI | InChI=1S/C13H19N3O2S/c1-8-11(12(17)18)19-13(14-8)15-9-5-7-16-6-3-2-4-10(9)16/h9-10H,2-7H2,1H3,(H,14,15)(H,17,18) |
| InChIKey | GUKZZDULPKGGLM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |