C14H21N3O2S — CID 80568379
ethyl 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-1,3-thiazole-4-carboxylate (PubChem CID 80568379) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is ethyl 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 80568379 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | ethyl 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NC2CCN3CCCCC23)n1 |
| InChI | InChI=1S/C14H21N3O2S/c1-2-19-13(18)11-9-20-14(16-11)15-10-6-8-17-7-4-3-5-12(10)17/h9-10,12H,2-8H2,1H3,(H,15,16) |
| InChIKey | KICOVFZUFSXISU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |