C10H18N4O2S2 — CID 103364864
4-ethylsulfonyl-5-N-piperidin-1-yl-1,2-thiazole-3,5-diamine (PubChem CID 103364864) has the molecular formula C10H18N4O2S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-ethylsulfonyl-5-N-piperidin-1-yl-1,2-thiazole-3,5-diamine.
| Compound Name | 4-ethylsulfonyl-5-N-piperidin-1-yl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103364864 |
| Molecular Formula | C10H18N4O2S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-ethylsulfonyl-5-N-piperidin-1-yl-1,2-thiazole-3,5-diamine |
| SMILES | CCS(=O)(=O)c1c(N)nsc1NN1CCCCC1 |
| InChI | InChI=1S/C10H18N4O2S2/c1-2-18(15,16)8-9(11)13-17-10(8)12-14-6-4-3-5-7-14/h12H,2-7H2,1H3,(H2,11,13) |
| InChIKey | RNGBLYCJKMLQOA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |