C13H23N3O2S2 — CID 103360972
5-N-(1-cyclohexylethyl)-4-ethylsulfonyl-1,2-thiazole-3,5-diamine (PubChem CID 103360972) has the molecular formula C13H23N3O2S2 and a molecular weight of 317.48 g/mol. Its IUPAC name is 5-N-(1-cyclohexylethyl)-4-ethylsulfonyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(1-cyclohexylethyl)-4-ethylsulfonyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103360972 |
| Molecular Formula | C13H23N3O2S2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 5-N-(1-cyclohexylethyl)-4-ethylsulfonyl-1,2-thiazole-3,5-diamine |
| SMILES | CCS(=O)(=O)c1c(N)nsc1NC(C)C1CCCCC1 |
| InChI | InChI=1S/C13H23N3O2S2/c1-3-20(17,18)11-12(14)16-19-13(11)15-9(2)10-7-5-4-6-8-10/h9-10,15H,3-8H2,1-2H3,(H2,14,16) |
| InChIKey | APZITBVTGWMCQO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |