C12H21N3O2S2 — CID 103365777
5-N-(1-cyclobutylethyl)-4-propylsulfonyl-1,2-thiazole-3,5-diamine (PubChem CID 103365777) has the molecular formula C12H21N3O2S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 5-N-(1-cyclobutylethyl)-4-propylsulfonyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(1-cyclobutylethyl)-4-propylsulfonyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103365777 |
| Molecular Formula | C12H21N3O2S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 5-N-(1-cyclobutylethyl)-4-propylsulfonyl-1,2-thiazole-3,5-diamine |
| SMILES | CCCS(=O)(=O)c1c(N)nsc1NC(C)C1CCC1 |
| InChI | InChI=1S/C12H21N3O2S2/c1-3-7-19(16,17)10-11(13)15-18-12(10)14-8(2)9-5-4-6-9/h8-9,14H,3-7H2,1-2H3,(H2,13,15) |
| InChIKey | QKNUHORQFSJZCV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |