C9H16N4OS — CID 103383775
4-methoxy-5-N-piperidin-1-yl-1,2-thiazole-3,5-diamine (PubChem CID 103383775) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-methoxy-5-N-piperidin-1-yl-1,2-thiazole-3,5-diamine.
| Compound Name | 4-methoxy-5-N-piperidin-1-yl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103383775 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-methoxy-5-N-piperidin-1-yl-1,2-thiazole-3,5-diamine |
| SMILES | COc1c(N)nsc1NN1CCCCC1 |
| InChI | InChI=1S/C9H16N4OS/c1-14-7-8(10)12-15-9(7)11-13-5-3-2-4-6-13/h11H,2-6H2,1H3,(H2,10,12) |
| InChIKey | YUFGEMYAGMZSPH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |