C10H17N3O2S — CID 103382934
4-methoxy-5-N-[1-(oxolan-2-yl)ethyl]-1,2-thiazole-3,5-diamine (PubChem CID 103382934) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 4-methoxy-5-N-[1-(oxolan-2-yl)ethyl]-1,2-thiazole-3,5-diamine.
| Compound Name | 4-methoxy-5-N-[1-(oxolan-2-yl)ethyl]-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103382934 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 4-methoxy-5-N-[1-(oxolan-2-yl)ethyl]-1,2-thiazole-3,5-diamine |
| SMILES | COc1c(N)nsc1NC(C)C1CCCO1 |
| InChI | InChI=1S/C10H17N3O2S/c1-6(7-4-3-5-15-7)12-10-8(14-2)9(11)13-16-10/h6-7,12H,3-5H2,1-2H3,(H2,11,13) |
| InChIKey | IICYYHPGNSCIFX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |