C11H18N2OS — CID 65169694
4,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,3-thiazol-2-amine (PubChem CID 65169694) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 4,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | 4,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 65169694 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,3-thiazol-2-amine |
| SMILES | Cc1nc(NC(C)C2CCCO2)sc1C |
| InChI | InChI=1S/C11H18N2OS/c1-7-9(3)15-11(12-7)13-8(2)10-5-4-6-14-10/h8,10H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | GKJADCIGYRZATD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |