C8H13N3O2 — CID 130840823
N-[1-(oxolan-2-yl)ethyl]-1,3,4-oxadiazol-2-amine (PubChem CID 130840823) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is N-[1-(oxolan-2-yl)ethyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | N-[1-(oxolan-2-yl)ethyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 130840823 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-[1-(oxolan-2-yl)ethyl]-1,3,4-oxadiazol-2-amine |
| SMILES | CC(Nc1nnco1)C1CCCO1 |
| InChI | InChI=1S/C8H13N3O2/c1-6(7-3-2-4-12-7)10-8-11-9-5-13-8/h5-7H,2-4H2,1H3,(H,10,11) |
| InChIKey | FDNWGBXVPGSFFC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |