C11H18N4O — CID 80780884
2-methyl-4-N-[1-(oxolan-2-yl)ethyl]pyrimidine-4,6-diamine (PubChem CID 80780884) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-methyl-4-N-[1-(oxolan-2-yl)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 2-methyl-4-N-[1-(oxolan-2-yl)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80780884 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-methyl-4-N-[1-(oxolan-2-yl)ethyl]pyrimidine-4,6-diamine |
| SMILES | Cc1nc(N)cc(NC(C)C2CCCO2)n1 |
| InChI | InChI=1S/C11H18N4O/c1-7(9-4-3-5-16-9)13-11-6-10(12)14-8(2)15-11/h6-7,9H,3-5H2,1-2H3,(H3,12,13,14,15) |
| InChIKey | ISMKKWQLUAUEDA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |