C9H16N4O — CID 82236284
4-N-[1-(oxolan-2-yl)ethyl]-1H-pyrazole-4,5-diamine (PubChem CID 82236284) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-N-[1-(oxolan-2-yl)ethyl]-1H-pyrazole-4,5-diamine.
| Compound Name | 4-N-[1-(oxolan-2-yl)ethyl]-1H-pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 82236284 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 4-N-[1-(oxolan-2-yl)ethyl]-1H-pyrazole-4,5-diamine |
| SMILES | CC(Nc1cn[nH]c1N)C1CCCO1 |
| InChI | InChI=1S/C9H16N4O/c1-6(8-3-2-4-14-8)12-7-5-11-13-9(7)10/h5-6,8,12H,2-4H2,1H3,(H3,10,11,13) |
| InChIKey | ADCJRPRPQRMZCW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |