C9H13ClN4O — CID 82237452
3-chloro-N-[1-(oxolan-2-yl)ethyl]-1,2,4-triazin-5-amine (PubChem CID 82237452) has the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. Its IUPAC name is 3-chloro-N-[1-(oxolan-2-yl)ethyl]-1,2,4-triazin-5-amine.
| Compound Name | 3-chloro-N-[1-(oxolan-2-yl)ethyl]-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 82237452 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 3-chloro-N-[1-(oxolan-2-yl)ethyl]-1,2,4-triazin-5-amine |
| SMILES | CC(Nc1cnnc(Cl)n1)C1CCCO1 |
| InChI | InChI=1S/C9H13ClN4O/c1-6(7-3-2-4-15-7)12-8-5-11-14-9(10)13-8/h5-7H,2-4H2,1H3,(H,12,13,14) |
| InChIKey | HYGMSAIFNSPBLW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |