C8H15N3O2S — CID 103382876
2-[(3-amino-4-methoxy-1,2-thiazol-5-yl)amino]butan-1-ol (PubChem CID 103382876) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-[(3-amino-4-methoxy-1,2-thiazol-5-yl)amino]butan-1-ol.
| Compound Name | 2-[(3-amino-4-methoxy-1,2-thiazol-5-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 103382876 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-[(3-amino-4-methoxy-1,2-thiazol-5-yl)amino]butan-1-ol |
| SMILES | CCC(CO)Nc1snc(N)c1OC |
| InChI | InChI=1S/C8H15N3O2S/c1-3-5(4-12)10-8-6(13-2)7(9)11-14-8/h5,10,12H,3-4H2,1-2H3,(H2,9,11) |
| InChIKey | QZWPUJBOHINWPB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |