C12H20N4O — CID 114115082
6-N-[1-(oxan-4-yl)ethyl]pyridine-2,3,6-triamine (PubChem CID 114115082) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 6-N-[1-(oxan-4-yl)ethyl]pyridine-2,3,6-triamine.
| Compound Name | 6-N-[1-(oxan-4-yl)ethyl]pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 114115082 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 6-N-[1-(oxan-4-yl)ethyl]pyridine-2,3,6-triamine |
| SMILES | CC(Nc1ccc(N)c(N)n1)C1CCOCC1 |
| InChI | InChI=1S/C12H20N4O/c1-8(9-4-6-17-7-5-9)15-11-3-2-10(13)12(14)16-11/h2-3,8-9H,4-7,13H2,1H3,(H3,14,15,16) |
| InChIKey | HTSCIBJMCYRCLP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |