C25H33N5O4 — CID 172981285
(NE)-N-[(4Z)-4-[9-(1-aminobutyl)-9-(butylamino)-7-nitrofluoren-2-yl]-4-hydroxyiminobutan-2-ylidene]hydroxylamine (PubChem CID 172981285) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is (NE)-N-[(4Z)-4-[9-(1-aminobutyl)-9-(butylamino)-7-nitrofluoren-2-yl]-4-hydroxyiminobutan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4Z)-4-[9-(1-aminobutyl)-9-(butylamino)-7-nitrofluoren-2-yl]-4-hydroxyiminobutan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 172981285 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | (NE)-N-[(4Z)-4-[9-(1-aminobutyl)-9-(butylamino)-7-nitrofluoren-2-yl]-4-hydroxyiminobutan-2-ylidene]hydroxylamine |
| SMILES | CCCCNC1(C(N)CCC)c2cc(/C(C/C(C)=N/O)=N\O)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C25H33N5O4/c1-4-6-12-27-25(24(26)7-5-2)21-14-17(23(29-32)13-16(3)28-31)8-10-19(21)20-11-9-18(30(33)34)15-22(20)25/h8-11,14-15,24,27,31-32H,4-7,12-13,26H2,1-3H3/b28-16+,29-23- |
| InChIKey | NALBWJTUYMPIGM-MOTHXLQOSA-N |
| XLogP | 4.75 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|