C30H39N3O4 — CID 145133751
1-[9-(1-aminobutyl)-9-(butylamino)-7-nitrofluoren-2-yl]-3-cyclohexylpropane-1,3-dione (PubChem CID 145133751) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is 1-[9-(1-aminobutyl)-9-(butylamino)-7-nitrofluoren-2-yl]-3-cyclohexylpropane-1,3-dione.
| Compound Name | 1-[9-(1-aminobutyl)-9-(butylamino)-7-nitrofluoren-2-yl]-3-cyclohexylpropane-1,3-dione |
|---|---|
| PubChem CID | 145133751 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 1-[9-(1-aminobutyl)-9-(butylamino)-7-nitrofluoren-2-yl]-3-cyclohexylpropane-1,3-dione |
| SMILES | CCCCNC1(C(N)CCC)c2cc(C(=O)CC(=O)C3CCCCC3)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C30H39N3O4/c1-3-5-16-32-30(29(31)9-4-2)25-17-21(28(35)19-27(34)20-10-7-6-8-11-20)12-14-23(25)24-15-13-22(33(36)37)18-26(24)30/h12-15,17-18,20,29,32H,3-11,16,19,31H2,1-2H3 |
| InChIKey | VDDBEWKMKLPGDU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|