C38H51N5O6 — CID 145133721
[(E)-[(1E)-1-[9-(1-aminobutyl)-9-(butylamino)-7-nitrofluoren-2-yl]-1-(cyclohexanecarbonyloxyimino)propan-2-ylidene]amino] cyclohexanecarboxylate (PubChem CID 145133721) has the molecular formula C38H51N5O6 and a molecular weight of 673.85 g/mol. Its IUPAC name is [(E)-[(1E)-1-[9-(1-aminobutyl)-9-(butylamino)-7-nitrofluoren-2-yl]-1-(cyclohexanecarbonyloxyimino)propan-2-ylidene]amino] cyclohexanecarboxylate.
| Compound Name | [(E)-[(1E)-1-[9-(1-aminobutyl)-9-(butylamino)-7-nitrofluoren-2-yl]-1-(cyclohexanecarbonyloxyimino)propan-2-ylidene]amino] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 145133721 |
| Molecular Formula | C38H51N5O6 |
| Molecular Weight | 673.85 g/mol |
| Exact Mass | 673.38 |
| IUPAC Name | [(E)-[(1E)-1-[9-(1-aminobutyl)-9-(butylamino)-7-nitrofluoren-2-yl]-1-(cyclohexanecarbonyloxyimino)propan-2-ylidene]amino] cyclohexanecarboxylate |
| SMILES | CCCCNC1(C(N)CCC)c2cc(C(=N\OC(=O)C3CCCCC3)/C(C)=N/OC(=O)C3CCCCC3)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C38H51N5O6/c1-4-6-22-40-38(34(39)13-5-2)32-23-28(18-20-30(32)31-21-19-29(43(46)47)24-33(31)38)35(42-49-37(45)27-16-11-8-12-17-27)25(3)41-48-36(44)26-14-9-7-10-15-26/h18-21,23-24,26-27,34,40H,4-17,22,39H2,1-3H3/b41-25+,42-35- |
| InChIKey | DGKBQRGOLZRDRJ-QKNZXJTNSA-N |
| XLogP | 7.66 |
| TPSA | 158.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.85 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|