C30H40N4O4 — CID 145133740
[(E)-[(4E)-4-acetyloxyimino-4-[9-(1-aminobutyl)-9-(butylamino)-7-methylfluoren-2-yl]butan-2-ylidene]amino] acetate (PubChem CID 145133740) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is [(E)-[(4E)-4-acetyloxyimino-4-[9-(1-aminobutyl)-9-(butylamino)-7-methylfluoren-2-yl]butan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[(4E)-4-acetyloxyimino-4-[9-(1-aminobutyl)-9-(butylamino)-7-methylfluoren-2-yl]butan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 145133740 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | [(E)-[(4E)-4-acetyloxyimino-4-[9-(1-aminobutyl)-9-(butylamino)-7-methylfluoren-2-yl]butan-2-ylidene]amino] acetate |
| SMILES | CCCCNC1(C(N)CCC)c2cc(C)ccc2-c2ccc(/C(C/C(C)=N/OC(C)=O)=N/OC(C)=O)cc21 |
| InChI | InChI=1S/C30H40N4O4/c1-7-9-15-32-30(29(31)10-8-2)26-16-19(3)11-13-24(26)25-14-12-23(18-27(25)30)28(34-38-22(6)36)17-20(4)33-37-21(5)35/h11-14,16,18,29,32H,7-10,15,17,31H2,1-6H3/b33-20+,34-28+ |
| InChIKey | CDPHQXKJDWDAJE-ITHGATNSSA-N |
| XLogP | 5.33 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|