C42H54N2O4 — CID 118371828
[acetyl-[4-[9,9-dihexyl-7-(4-methylbenzoyl)fluoren-2-yl]-4-methyliminobutan-2-yl]amino] acetate (PubChem CID 118371828) has the molecular formula C42H54N2O4 and a molecular weight of 650.90 g/mol. Its IUPAC name is [acetyl-[4-[9,9-dihexyl-7-(4-methylbenzoyl)fluoren-2-yl]-4-methyliminobutan-2-yl]amino] acetate.
| Compound Name | [acetyl-[4-[9,9-dihexyl-7-(4-methylbenzoyl)fluoren-2-yl]-4-methyliminobutan-2-yl]amino] acetate |
|---|---|
| PubChem CID | 118371828 |
| Molecular Formula | C42H54N2O4 |
| Molecular Weight | 650.90 g/mol |
| Exact Mass | 650.41 |
| IUPAC Name | [acetyl-[4-[9,9-dihexyl-7-(4-methylbenzoyl)fluoren-2-yl]-4-methyliminobutan-2-yl]amino] acetate |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C(=O)c3ccc(C)cc3)ccc2-c2ccc(/C(CC(C)N(OC(C)=O)C(C)=O)=N/C)cc21 |
| InChI | InChI=1S/C42H54N2O4/c1-8-10-12-14-24-42(25-15-13-11-9-2)38-27-34(40(43-7)26-30(4)44(31(5)45)48-32(6)46)20-22-36(38)37-23-21-35(28-39(37)42)41(47)33-18-16-29(3)17-19-33/h16-23,27-28,30H,8-15,24-26H2,1-7H3/b43-40+ |
| InChIKey | PSUBRXDJZFYHFI-WDHDNBHHSA-N |
| XLogP | 9.96 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.90 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|