C33H38O3 — CID 167065608
3-cyclohexyl-1-[7-(furan-3-carbonyl)-9,9-dipropylfluoren-2-yl]propan-1-one (PubChem CID 167065608) has the molecular formula C33H38O3 and a molecular weight of 482.66 g/mol. Its IUPAC name is 3-cyclohexyl-1-[7-(furan-3-carbonyl)-9,9-dipropylfluoren-2-yl]propan-1-one.
| Compound Name | 3-cyclohexyl-1-[7-(furan-3-carbonyl)-9,9-dipropylfluoren-2-yl]propan-1-one |
|---|---|
| PubChem CID | 167065608 |
| Molecular Formula | C33H38O3 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 3-cyclohexyl-1-[7-(furan-3-carbonyl)-9,9-dipropylfluoren-2-yl]propan-1-one |
| SMILES | CCCC1(CCC)c2cc(C(=O)CCC3CCCCC3)ccc2-c2ccc(C(=O)c3ccoc3)cc21 |
| InChI | InChI=1S/C33H38O3/c1-3-17-33(18-4-2)29-20-24(31(34)15-10-23-8-6-5-7-9-23)11-13-27(29)28-14-12-25(21-30(28)33)32(35)26-16-19-36-22-26/h11-14,16,19-23H,3-10,15,17-18H2,1-2H3 |
| InChIKey | XIOODOPVBKSIRY-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |