C21H28O — CID 145472183
3-cyclohexyl-1-(7-methylidene-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl)propan-1-one (PubChem CID 145472183) has the molecular formula C21H28O and a molecular weight of 296.45 g/mol. Its IUPAC name is 3-cyclohexyl-1-(7-methylidene-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl)propan-1-one.
| Compound Name | 3-cyclohexyl-1-(7-methylidene-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl)propan-1-one |
|---|---|
| PubChem CID | 145472183 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 3-cyclohexyl-1-(7-methylidene-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl)propan-1-one |
| SMILES | C=C1CCc2ccc(C(=O)CCC3CCCCC3)cc2CC1 |
| InChI | InChI=1S/C21H28O/c1-16-7-10-18-12-13-20(15-19(18)11-8-16)21(22)14-9-17-5-3-2-4-6-17/h12-13,15,17H,1-11,14H2 |
| InChIKey | UKFXYZZTXBOAMA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|