C23H31F3N2O4 — CID 21108451
N-(cyclohexylmethyl)-4-oxo-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butanamide;2,2,2-trifluoroacetic acid (PubChem CID 21108451) has the molecular formula C23H31F3N2O4 and a molecular weight of 456.51 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-4-oxo-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(cyclohexylmethyl)-4-oxo-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 21108451 |
| Molecular Formula | C23H31F3N2O4 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N-(cyclohexylmethyl)-4-oxo-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butanamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)CCNCC2)NCC1CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H30N2O2.C2HF3O2/c24-20(8-9-21(25)23-15-16-4-2-1-3-5-16)19-7-6-17-10-12-22-13-11-18(17)14-19;3-2(4,5)1(6)7/h6-7,14,16,22H,1-5,8-13,15H2,(H,23,25);(H,6,7) |
| InChIKey | QHPAMVNDJJNZAE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |