C25H35F3N2O4 — CID 167877196
4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide;2,2,2-trifluoroacetic acid (PubChem CID 167877196) has the molecular formula C25H35F3N2O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167877196 |
| Molecular Formula | C25H35F3N2O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC1(C)CC(NC(=O)CCC(=O)c2ccc3c(c2)CCCC3)CC(C)(C)N1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H34N2O2.C2HF3O2/c1-22(2)14-19(15-23(3,4)25-22)24-21(27)12-11-20(26)18-10-9-16-7-5-6-8-17(16)13-18;3-2(4,5)1(6)7/h9-10,13,19,25H,5-8,11-12,14-15H2,1-4H3,(H,24,27);(H,6,7) |
| InChIKey | KQAJOIFBQSYAIP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |