C24H23N3O4 — CID 122485337
9,9-diethyl-2,7-bis[(2E)-2-hydroxyiminopropanoyl]fluorene-4-carbonitrile (PubChem CID 122485337) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 9,9-diethyl-2,7-bis[(2E)-2-hydroxyiminopropanoyl]fluorene-4-carbonitrile.
| Compound Name | 9,9-diethyl-2,7-bis[(2E)-2-hydroxyiminopropanoyl]fluorene-4-carbonitrile |
|---|---|
| PubChem CID | 122485337 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 9,9-diethyl-2,7-bis[(2E)-2-hydroxyiminopropanoyl]fluorene-4-carbonitrile |
| SMILES | CCC1(CC)c2cc(C(=O)/C(C)=N/O)ccc2-c2c(C#N)cc(C(=O)/C(C)=N/O)cc21 |
| InChI | InChI=1S/C24H23N3O4/c1-5-24(6-2)19-10-15(22(28)13(3)26-30)7-8-18(19)21-17(12-25)9-16(11-20(21)24)23(29)14(4)27-31/h7-11,30-31H,5-6H2,1-4H3/b26-13+,27-14+ |
| InChIKey | XQYPVMAJSNADCB-BMNRKXRESA-N |
| XLogP | 4.71 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|