C35H40N4O8 — CID 130265637
[(E)-[1-cyclohexyl-2-[6-[(2E)-2-cyclohexyl-2-propanoyloxyiminoacetyl]-9-methyl-8-nitrocarbazol-3-yl]-2-oxoethylidene]amino] propanoate (PubChem CID 130265637) has the molecular formula C35H40N4O8 and a molecular weight of 644.73 g/mol. Its IUPAC name is [(E)-[1-cyclohexyl-2-[6-[(2E)-2-cyclohexyl-2-propanoyloxyiminoacetyl]-9-methyl-8-nitrocarbazol-3-yl]-2-oxoethylidene]amino] propanoate.
| Compound Name | [(E)-[1-cyclohexyl-2-[6-[(2E)-2-cyclohexyl-2-propanoyloxyiminoacetyl]-9-methyl-8-nitrocarbazol-3-yl]-2-oxoethylidene]amino] propanoate |
|---|---|
| PubChem CID | 130265637 |
| Molecular Formula | C35H40N4O8 |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | [(E)-[1-cyclohexyl-2-[6-[(2E)-2-cyclohexyl-2-propanoyloxyiminoacetyl]-9-methyl-8-nitrocarbazol-3-yl]-2-oxoethylidene]amino] propanoate |
| SMILES | CCC(=O)O/N=C(/C(=O)c1ccc2c(c1)c1cc(C(=O)/C(=N/OC(=O)CC)C3CCCCC3)cc([N+](=O)[O-])c1n2C)C1CCCCC1 |
| InChI | InChI=1S/C35H40N4O8/c1-4-29(40)46-36-31(21-12-8-6-9-13-21)34(42)23-16-17-27-25(18-23)26-19-24(20-28(39(44)45)33(26)38(27)3)35(43)32(37-47-30(41)5-2)22-14-10-7-11-15-22/h16-22H,4-15H2,1-3H3/b36-31+,37-32+ |
| InChIKey | UWZVRFHXXJSEFH-NBTMAVPQSA-N |
| XLogP | 7.38 |
| TPSA | 159.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|