C34H43N3O8 — CID 144922686
[(E)-[1-[6-(2,3-dimethylpent-2-enoyl)-9-(4-methylhexyl)-8-nitrocarbazol-3-yl]-1-oxopropan-2-ylidene]amino] acetate;methyl acetate (PubChem CID 144922686) has the molecular formula C34H43N3O8 and a molecular weight of 621.73 g/mol. Its IUPAC name is [(E)-[1-[6-(2,3-dimethylpent-2-enoyl)-9-(4-methylhexyl)-8-nitrocarbazol-3-yl]-1-oxopropan-2-ylidene]amino] acetate;methyl acetate.
| Compound Name | [(E)-[1-[6-(2,3-dimethylpent-2-enoyl)-9-(4-methylhexyl)-8-nitrocarbazol-3-yl]-1-oxopropan-2-ylidene]amino] acetate;methyl acetate |
|---|---|
| PubChem CID | 144922686 |
| Molecular Formula | C34H43N3O8 |
| Molecular Weight | 621.73 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | [(E)-[1-[6-(2,3-dimethylpent-2-enoyl)-9-(4-methylhexyl)-8-nitrocarbazol-3-yl]-1-oxopropan-2-ylidene]amino] acetate;methyl acetate |
| SMILES | CCC(C)=C(C)C(=O)c1cc([N+](=O)[O-])c2c(c1)c1cc(C(=O)/C(C)=N/OC(C)=O)ccc1n2CCCC(C)CC.COC(C)=O |
| InChI | InChI=1S/C31H37N3O6.C3H6O2/c1-8-18(3)11-10-14-33-27-13-12-23(31(37)21(6)32-40-22(7)35)15-25(27)26-16-24(17-28(29(26)33)34(38)39)30(36)20(5)19(4)9-2;1-3(4)5-2/h12-13,15-18H,8-11,14H2,1-7H3;1-2H3/b20-19?,32-21+; |
| InChIKey | FGZOWAFYNRAEMB-ZPHPBDEXSA-N |
| XLogP | 7.76 |
| TPSA | 147.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.73 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|