C25H27N3O6 — CID 172929963
[(Z)-[1-cyclohexyl-2-[4-(2-nitro-4-nitrosophenyl)phenyl]-2-oxoethylidene]amino] pentanoate (PubChem CID 172929963) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is [(Z)-[1-cyclohexyl-2-[4-(2-nitro-4-nitrosophenyl)phenyl]-2-oxoethylidene]amino] pentanoate.
| Compound Name | [(Z)-[1-cyclohexyl-2-[4-(2-nitro-4-nitrosophenyl)phenyl]-2-oxoethylidene]amino] pentanoate |
|---|---|
| PubChem CID | 172929963 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | [(Z)-[1-cyclohexyl-2-[4-(2-nitro-4-nitrosophenyl)phenyl]-2-oxoethylidene]amino] pentanoate |
| SMILES | CCCCC(=O)O/N=C(\C(=O)c1ccc(-c2ccc(N=O)cc2[N+](=O)[O-])cc1)C1CCCCC1 |
| InChI | InChI=1S/C25H27N3O6/c1-2-3-9-23(29)34-27-24(18-7-5-4-6-8-18)25(30)19-12-10-17(11-13-19)21-15-14-20(26-31)16-22(21)28(32)33/h10-16,18H,2-9H2,1H3/b27-24- |
| InChIKey | PMCITLMWTMHTSZ-PNHLSOANSA-N |
| XLogP | 6.51 |
| TPSA | 128.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|