C48H38N4O10 — CID 144839266
[(Z)-[2-[4-(4-nitrophenyl)phenyl]-2-oxo-1-phenylethylidene]amino] 4-[3-[4-[(2Z)-2-butanoyloxyimino-2-phenylacetyl]phenyl]-4-nitrophenyl]butanoate (PubChem CID 144839266) has the molecular formula C48H38N4O10 and a molecular weight of 830.85 g/mol. Its IUPAC name is [(Z)-[2-[4-(4-nitrophenyl)phenyl]-2-oxo-1-phenylethylidene]amino] 4-[3-[4-[(2Z)-2-butanoyloxyimino-2-phenylacetyl]phenyl]-4-nitrophenyl]butanoate.
| Compound Name | [(Z)-[2-[4-(4-nitrophenyl)phenyl]-2-oxo-1-phenylethylidene]amino] 4-[3-[4-[(2Z)-2-butanoyloxyimino-2-phenylacetyl]phenyl]-4-nitrophenyl]butanoate |
|---|---|
| PubChem CID | 144839266 |
| Molecular Formula | C48H38N4O10 |
| Molecular Weight | 830.85 g/mol |
| Exact Mass | 830.26 |
| IUPAC Name | [(Z)-[2-[4-(4-nitrophenyl)phenyl]-2-oxo-1-phenylethylidene]amino] 4-[3-[4-[(2Z)-2-butanoyloxyimino-2-phenylacetyl]phenyl]-4-nitrophenyl]butanoate |
| SMILES | CCCC(=O)O/N=C(\C(=O)c1ccc(-c2cc(CCCC(=O)O/N=C(\C(=O)c3ccc(-c4ccc([N+](=O)[O-])cc4)cc3)c3ccccc3)ccc2[N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C48H38N4O10/c1-2-10-43(53)61-49-45(36-12-5-3-6-13-36)48(56)39-24-20-35(21-25-39)41-31-32(17-30-42(41)52(59)60)11-9-16-44(54)62-50-46(37-14-7-4-8-15-37)47(55)38-22-18-33(19-23-38)34-26-28-40(29-27-34)51(57)58/h3-8,12-15,17-31H,2,9-11,16H2,1H3/b49-45-,50-46- |
| InChIKey | XJGNBLAUOXLREZ-FXVBOROLSA-N |
| XLogP | 9.92 |
| TPSA | 197.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.85 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|