C40H23BBrN3 — CID 163822943
CID 163822943 (PubChem CID 163822943) has the molecular formula C40H23BBrN3 and a molecular weight of 636.36 g/mol.
| Compound Name | CID 163822943 |
|---|---|
| PubChem CID | 163822943 |
| Molecular Formula | C40H23BBrN3 |
| Molecular Weight | 636.36 g/mol |
| Exact Mass | 635.12 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C1(c3ccccc3-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc31)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C40H23BBrN3/c41-27-16-19-31-32-20-17-28(42)23-36(32)40(35(31)22-27)33-14-8-7-13-29(33)30-18-15-26(21-34(30)40)39-44-37(24-9-3-1-4-10-24)43-38(45-39)25-11-5-2-6-12-25/h1-23H |
| InChIKey | XOWRIIGDWARXSI-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.36 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|