C15H16B2O4 — CID 24820467
(7-borono-9,9-dimethylfluoren-2-yl)boronic acid (PubChem CID 24820467) has the molecular formula C15H16B2O4 and a molecular weight of 281.91 g/mol. Its IUPAC name is (7-borono-9,9-dimethylfluoren-2-yl)boronic acid.
| Compound Name | (7-borono-9,9-dimethylfluoren-2-yl)boronic acid |
|---|---|
| PubChem CID | 24820467 |
| Molecular Formula | C15H16B2O4 |
| Molecular Weight | 281.91 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (7-borono-9,9-dimethylfluoren-2-yl)boronic acid |
| SMILES | CC1(C)c2cc(B(O)O)ccc2-c2ccc(B(O)O)cc21 |
| InChI | InChI=1S/C15H16B2O4/c1-15(2)13-7-9(16(18)19)3-5-11(13)12-6-4-10(17(20)21)8-14(12)15/h3-8,18-21H,1-2H3 |
| InChIKey | LUVUGOUOAXADNE-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.91 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|