C15H15BO2S — CID 163509290
(9,9-dimethylthioxanthen-2-yl)boronic acid (PubChem CID 163509290) has the molecular formula C15H15BO2S and a molecular weight of 270.16 g/mol. Its IUPAC name is (9,9-dimethylthioxanthen-2-yl)boronic acid.
| Compound Name | (9,9-dimethylthioxanthen-2-yl)boronic acid |
|---|---|
| PubChem CID | 163509290 |
| Molecular Formula | C15H15BO2S |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (9,9-dimethylthioxanthen-2-yl)boronic acid |
| SMILES | CC1(C)c2ccccc2Sc2ccc(B(O)O)cc21 |
| InChI | InChI=1S/C15H15BO2S/c1-15(2)11-5-3-4-6-13(11)19-14-8-7-10(16(17)18)9-12(14)15/h3-9,17-18H,1-2H3 |
| InChIKey | DBHCJZGNWCHPRQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|