(9,9-dimethylthioxanthen-2-yl)boronic acid

C15H15BO2S — CID 163509290

IUPAC(9,9-dimethylthioxanthen-2-yl)boronic acid
SMILESCC1(C)c2ccccc2Sc2ccc(B(O)O)cc21
InChIInChI=1S/C15H15BO2S/c1-15(2)11-5-3-4-6-13(11)19-14-8-7-10(16(17)18)9-12(14)15/h3-9,17-18H,1-2H3
InChIKeyDBHCJZGNWCHPRQ-UHFFFAOYSA-N
MW270.16 g/mol
LogP2.16
Rot. Bonds1

About (9,9-dimethylthioxanthen-2-yl)boronic acid

(9,9-dimethylthioxanthen-2-yl)boronic acid (PubChem CID 163509290) has the molecular formula C15H15BO2S and a molecular weight of 270.16 g/mol. Its IUPAC name is (9,9-dimethylthioxanthen-2-yl)boronic acid.

Molecular Properties

Compound Name(9,9-dimethylthioxanthen-2-yl)boronic acid
PubChem CID163509290
Molecular FormulaC15H15BO2S
Molecular Weight270.16 g/mol
Exact Mass270.09
IUPAC Name(9,9-dimethylthioxanthen-2-yl)boronic acid
SMILESCC1(C)c2ccccc2Sc2ccc(B(O)O)cc21
InChIInChI=1S/C15H15BO2S/c1-15(2)11-5-3-4-6-13(11)19-14-8-7-10(16(17)18)9-12(14)15/h3-9,17-18H,1-2H3
InChIKeyDBHCJZGNWCHPRQ-UHFFFAOYSA-N
XLogP2.16
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.16
LogP ≤ 52.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (9,9-dimethylthioxanthen-2-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (9,9-dimethylthioxanthen-2-yl)boronic acid?
The IUPAC name of (9,9-dimethylthioxanthen-2-yl)boronic acid (CID 163509290) is (9,9-dimethylthioxanthen-2-yl)boronic acid.
What is the SMILES notation for (9,9-dimethylthioxanthen-2-yl)boronic acid?
The canonical SMILES for (9,9-dimethylthioxanthen-2-yl)boronic acid is CC1(C)c2ccccc2Sc2ccc(B(O)O)cc21.
What is the InChIKey of (9,9-dimethylthioxanthen-2-yl)boronic acid?
The InChIKey is DBHCJZGNWCHPRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BO2S/c1-15(2)11-5-3-4-6-13(11)19-14-8-7-10(16(17)18)9-12(14)15/h3-9,17-18H,1-2H3.
What are the key properties of (9,9-dimethylthioxanthen-2-yl)boronic acid?
(9,9-dimethylthioxanthen-2-yl)boronic acid has a molecular weight of 270.16 g/mol, XLogP of 2.16, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9,9-dimethylthioxanthen-2-yl)boronic acid is sourced from PubChem (CID 163509290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).