C15H13ClS — CID 172804751
2-chloro-9,9-dimethylthioxanthene (PubChem CID 172804751) has the molecular formula C15H13ClS and a molecular weight of 260.79 g/mol. Its IUPAC name is 2-chloro-9,9-dimethylthioxanthene.
| Compound Name | 2-chloro-9,9-dimethylthioxanthene |
|---|---|
| PubChem CID | 172804751 |
| Molecular Formula | C15H13ClS |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-chloro-9,9-dimethylthioxanthene |
| SMILES | CC1(C)c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H13ClS/c1-15(2)11-5-3-4-6-13(11)17-14-8-7-10(16)9-12(14)15/h3-9H,1-2H3 |
| InChIKey | RIVSCDILVLVWFI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |