C18H15ClOS — CID 12897976
2'-chlorospiro[cyclohexane-4,9'-thioxanthene]-1-one (PubChem CID 12897976) has the molecular formula C18H15ClOS and a molecular weight of 314.84 g/mol. Its IUPAC name is 2'-chlorospiro[cyclohexane-4,9'-thioxanthene]-1-one.
| Compound Name | 2'-chlorospiro[cyclohexane-4,9'-thioxanthene]-1-one |
|---|---|
| PubChem CID | 12897976 |
| Molecular Formula | C18H15ClOS |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2'-chlorospiro[cyclohexane-4,9'-thioxanthene]-1-one |
| SMILES | O=C1CCC2(CC1)c1ccccc1Sc1ccc(Cl)cc12 |
| InChI | InChI=1S/C18H15ClOS/c19-12-5-6-17-15(11-12)18(9-7-13(20)8-10-18)14-3-1-2-4-16(14)21-17/h1-6,11H,7-10H2 |
| InChIKey | ZXVCNNQZQJREPL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |