About 2'-methylspiro[cyclohexane-1,9'-thioxanthene]
2'-methylspiro[cyclohexane-1,9'-thioxanthene] (PubChem CID 69166832) has the molecular formula C19H20S
and a molecular weight of 280.44 g/mol. Its IUPAC name is 2'-methylspiro[cyclohexane-1,9'-thioxanthene].
Molecular Properties
| Compound Name | 2'-methylspiro[cyclohexane-1,9'-thioxanthene] |
| PubChem CID | 69166832 |
| Molecular Formula | C19H20S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2'-methylspiro[cyclohexane-1,9'-thioxanthene] |
| SMILES | Cc1ccc2c(c1)C1(CCCCC1)c1ccccc1S2 |
| InChI | InChI=1S/C19H20S/c1-14-9-10-18-16(13-14)19(11-5-2-6-12-19)15-7-3-4-8-17(15)20-18/h3-4,7-10,13H,2,5-6,11-12H2,1H3 |
| InChIKey | MBQXNFYNMASXAW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2'-methylspiro[cyclohexane-1,9'-thioxanthene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-methylspiro[cyclohexane-1,9'-thioxanthene]?
The IUPAC name of 2'-methylspiro[cyclohexane-1,9'-thioxanthene] (CID 69166832) is 2'-methylspiro[cyclohexane-1,9'-thioxanthene].
What is the SMILES notation for 2'-methylspiro[cyclohexane-1,9'-thioxanthene]?
The canonical SMILES for 2'-methylspiro[cyclohexane-1,9'-thioxanthene] is Cc1ccc2c(c1)C1(CCCCC1)c1ccccc1S2.
What is the InChIKey of 2'-methylspiro[cyclohexane-1,9'-thioxanthene]?
The InChIKey is MBQXNFYNMASXAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20S/c1-14-9-10-18-16(13-14)19(11-5-2-6-12-19)15-7-3-4-8-17(15)20-18/h3-4,7-10,13H,2,5-6,11-12H2,1H3.
What are the key properties of 2'-methylspiro[cyclohexane-1,9'-thioxanthene]?
2'-methylspiro[cyclohexane-1,9'-thioxanthene] has a molecular weight of 280.44 g/mol, XLogP of 5.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-methylspiro[cyclohexane-1,9'-thioxanthene] is sourced from PubChem (CID 69166832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).