About 5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one
5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one (PubChem CID 159045261) has the molecular formula C15H17ClO2
and a molecular weight of 264.75 g/mol. Its IUPAC name is 5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one.
Molecular Properties
| Compound Name | 5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one |
| PubChem CID | 159045261 |
| Molecular Formula | C15H17ClO2 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one |
| SMILES | CC1(O)c2cc(Cl)ccc2CC12CCC(=O)CC2 |
| InChI | InChI=1S/C15H17ClO2/c1-14(18)13-8-11(16)3-2-10(13)9-15(14)6-4-12(17)5-7-15/h2-3,8,18H,4-7,9H2,1H3 |
| InChIKey | RYHVKJVAQCDDRV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one?
The IUPAC name of 5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one (CID 159045261) is 5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one.
What is the SMILES notation for 5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one?
The canonical SMILES for 5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one is CC1(O)c2cc(Cl)ccc2CC12CCC(=O)CC2.
What is the InChIKey of 5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one?
The InChIKey is RYHVKJVAQCDDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClO2/c1-14(18)13-8-11(16)3-2-10(13)9-15(14)6-4-12(17)5-7-15/h2-3,8,18H,4-7,9H2,1H3.
What are the key properties of 5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one?
5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one has a molecular weight of 264.75 g/mol, XLogP of 3.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-hydroxy-3-methylspiro[1H-indene-2,4'-cyclohexane]-1'-one is sourced from PubChem (CID 159045261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).