C12H12ClNO — CID 115033067
6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene (PubChem CID 115033067) has the molecular formula C12H12ClNO and a molecular weight of 221.69 g/mol. Its IUPAC name is 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene.
| Compound Name | 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 115033067 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene |
| SMILES | CC1(N=C=O)CCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H12ClNO/c1-12(14-8-15)6-2-3-9-4-5-10(13)7-11(9)12/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | MZEYEXYUTRMJMR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|