About 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene
6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene (PubChem CID 115033067) has the molecular formula C12H12ClNO
and a molecular weight of 221.69 g/mol. Its IUPAC name is 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene |
| PubChem CID | 115033067 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene |
| SMILES | CC1(N=C=O)CCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H12ClNO/c1-12(14-8-15)6-2-3-9-4-5-10(13)7-11(9)12/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | MZEYEXYUTRMJMR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene?
The IUPAC name of 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene (CID 115033067) is 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene.
What is the SMILES notation for 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene?
The canonical SMILES for 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene is CC1(N=C=O)CCCc2ccc(Cl)cc21.
What is the InChIKey of 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene?
The InChIKey is MZEYEXYUTRMJMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNO/c1-12(14-8-15)6-2-3-9-4-5-10(13)7-11(9)12/h4-5,7H,2-3,6H2,1H3.
What are the key properties of 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene?
6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene has a molecular weight of 221.69 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-isocyanato-4-methyl-2,3-dihydro-1H-naphthalene is sourced from PubChem (CID 115033067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).