C11H11NO2 — CID 115017736
1-isocyanato-1-methyl-2,3-dihydroinden-5-ol (PubChem CID 115017736) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 1-isocyanato-1-methyl-2,3-dihydroinden-5-ol.
| Compound Name | 1-isocyanato-1-methyl-2,3-dihydroinden-5-ol |
|---|---|
| PubChem CID | 115017736 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 1-isocyanato-1-methyl-2,3-dihydroinden-5-ol |
| SMILES | CC1(N=C=O)CCc2cc(O)ccc21 |
| InChI | InChI=1S/C11H11NO2/c1-11(12-7-13)5-4-8-6-9(14)2-3-10(8)11/h2-3,6,14H,4-5H2,1H3 |
| InChIKey | HQPMKFQBVXYEAF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|