About spiro[piperidine-4,9'-thioxanthene]
spiro[piperidine-4,9'-thioxanthene] (PubChem CID 22464014) has the molecular formula C17H17NS
and a molecular weight of 267.40 g/mol. Its IUPAC name is spiro[piperidine-4,9'-thioxanthene].
Molecular Properties
| Compound Name | spiro[piperidine-4,9'-thioxanthene] |
| PubChem CID | 22464014 |
| Molecular Formula | C17H17NS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | spiro[piperidine-4,9'-thioxanthene] |
| SMILES | c1ccc2c(c1)Sc1ccccc1C21CCNCC1 |
| InChI | InChI=1S/C17H17NS/c1-3-7-15-13(5-1)17(9-11-18-12-10-17)14-6-2-4-8-16(14)19-15/h1-8,18H,9-12H2 |
| InChIKey | LBIISXGOGWTZLZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[piperidine-4,9'-thioxanthene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[piperidine-4,9'-thioxanthene]?
The IUPAC name of spiro[piperidine-4,9'-thioxanthene] (CID 22464014) is spiro[piperidine-4,9'-thioxanthene].
What is the SMILES notation for spiro[piperidine-4,9'-thioxanthene]?
The canonical SMILES for spiro[piperidine-4,9'-thioxanthene] is c1ccc2c(c1)Sc1ccccc1C21CCNCC1.
What is the InChIKey of spiro[piperidine-4,9'-thioxanthene]?
The InChIKey is LBIISXGOGWTZLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NS/c1-3-7-15-13(5-1)17(9-11-18-12-10-17)14-6-2-4-8-16(14)19-15/h1-8,18H,9-12H2.
What are the key properties of spiro[piperidine-4,9'-thioxanthene]?
spiro[piperidine-4,9'-thioxanthene] has a molecular weight of 267.40 g/mol, XLogP of 3.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[piperidine-4,9'-thioxanthene] is sourced from PubChem (CID 22464014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).