C25H22N2S — CID 166908314
(Z)-1-(9,9-dimethylthioxanthen-2-yl)-4-phenylbut-2-ene-1,4-diimine (PubChem CID 166908314) has the molecular formula C25H22N2S and a molecular weight of 382.53 g/mol. Its IUPAC name is (Z)-1-(9,9-dimethylthioxanthen-2-yl)-4-phenylbut-2-ene-1,4-diimine.
| Compound Name | (Z)-1-(9,9-dimethylthioxanthen-2-yl)-4-phenylbut-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 166908314 |
| Molecular Formula | C25H22N2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (Z)-1-(9,9-dimethylthioxanthen-2-yl)-4-phenylbut-2-ene-1,4-diimine |
| SMILES | [H]/N=C(/C=C\C(=N\[H])c1ccc2c(c1)C(C)(C)c1ccccc1S2)c1ccccc1 |
| InChI | InChI=1S/C25H22N2S/c1-25(2)19-10-6-7-11-23(19)28-24-15-12-18(16-20(24)25)22(27)14-13-21(26)17-8-4-3-5-9-17/h3-16,26-27H,1-2H3/b14-13-,26-21-,27-22- |
| InChIKey | ADUODSWJPJQFTK-RWXAVVCESA-N |
| XLogP | 6.47 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|