C42H31N3S — CID 163740436
2-[3-[4-(9,9-dimethylthioxanthen-3-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 163740436) has the molecular formula C42H31N3S and a molecular weight of 609.80 g/mol. Its IUPAC name is 2-[3-[4-(9,9-dimethylthioxanthen-3-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[4-(9,9-dimethylthioxanthen-3-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 163740436 |
| Molecular Formula | C42H31N3S |
| Molecular Weight | 609.80 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | 2-[3-[4-(9,9-dimethylthioxanthen-3-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2Sc2cc(-c3ccc(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)cc3)ccc21 |
| InChI | InChI=1S/C42H31N3S/c1-42(2)35-18-9-10-19-37(35)46-38-27-33(24-25-36(38)42)29-22-20-28(21-23-29)32-16-11-17-34(26-32)41-44-39(30-12-5-3-6-13-30)43-40(45-41)31-14-7-4-8-15-31/h3-27H,1-2H3 |
| InChIKey | LHGBBDITDNUKLI-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.80 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |