C37H27N3S — CID 163714650
2-(9,9-dimethylthioxanthen-3-yl)-4-(6H-phenalen-2-yl)-6-phenyl-1,3,5-triazine (PubChem CID 163714650) has the molecular formula C37H27N3S and a molecular weight of 545.71 g/mol. Its IUPAC name is 2-(9,9-dimethylthioxanthen-3-yl)-4-(6H-phenalen-2-yl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylthioxanthen-3-yl)-4-(6H-phenalen-2-yl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 163714650 |
| Molecular Formula | C37H27N3S |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 2-(9,9-dimethylthioxanthen-3-yl)-4-(6H-phenalen-2-yl)-6-phenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2Sc2cc(-c3nc(-c4ccccc4)nc(-c4cc5c6c(cccc6c4)CC=C5)n3)ccc21 |
| InChI | InChI=1S/C37H27N3S/c1-37(2)29-16-6-7-17-31(29)41-32-22-27(18-19-30(32)37)35-38-34(24-10-4-3-5-11-24)39-36(40-35)28-20-25-14-8-12-23-13-9-15-26(21-28)33(23)25/h3-12,14-22H,13H2,1-2H3 |
| InChIKey | KMHGRKVDRNVTEP-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |