C37H28N2O2 — CID 138574374
(Z)-1-[2-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-19-yl)phenyl]-4-phenylbut-2-ene-1,4-diimine (PubChem CID 138574374) has the molecular formula C37H28N2O2 and a molecular weight of 532.64 g/mol. Its IUPAC name is (Z)-1-[2-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-19-yl)phenyl]-4-phenylbut-2-ene-1,4-diimine.
| Compound Name | (Z)-1-[2-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-19-yl)phenyl]-4-phenylbut-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 138574374 |
| Molecular Formula | C37H28N2O2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (Z)-1-[2-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-19-yl)phenyl]-4-phenylbut-2-ene-1,4-diimine |
| SMILES | [H]/N=C(/C=C\C(=N/[H])c1ccccc1-c1cccc2c1Oc1cc3c(cc1O2)C(C)(C)c1ccccc1-3)c1ccccc1 |
| InChI | InChI=1S/C37H28N2O2/c1-37(2)29-17-9-8-14-25(29)28-21-34-35(22-30(28)37)40-33-18-10-16-27(36(33)41-34)24-13-6-7-15-26(24)32(39)20-19-31(38)23-11-4-3-5-12-23/h3-22,38-39H,1-2H3/b20-19-,38-31-,39-32+ |
| InChIKey | IHPPIGQBBLZWEU-INVSMVASSA-N |
| XLogP | 9.55 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|