C50H33N3O2 — CID 138573858
2-[3-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-19-yl)phenyl]-4-phenanthren-2-yl-6-phenyl-1,3,5-triazine (PubChem CID 138573858) has the molecular formula C50H33N3O2 and a molecular weight of 707.83 g/mol. Its IUPAC name is 2-[3-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-19-yl)phenyl]-4-phenanthren-2-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[3-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-19-yl)phenyl]-4-phenanthren-2-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 138573858 |
| Molecular Formula | C50H33N3O2 |
| Molecular Weight | 707.83 g/mol |
| Exact Mass | 707.26 |
| IUPAC Name | 2-[3-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-19-yl)phenyl]-4-phenanthren-2-yl-6-phenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)Oc1cccc(-c2cccc(-c4nc(-c5ccccc5)nc(-c5ccc6c(ccc7ccccc76)c5)n4)c2)c1O3 |
| InChI | InChI=1S/C50H33N3O2/c1-50(2)41-20-9-8-18-39(41)40-28-44-45(29-42(40)50)54-43-21-11-19-38(46(43)55-44)32-15-10-16-34(26-32)48-51-47(31-13-4-3-5-14-31)52-49(53-48)35-24-25-37-33(27-35)23-22-30-12-6-7-17-36(30)37/h3-29H,1-2H3 |
| InChIKey | PCOKZSUOAARBRL-UHFFFAOYSA-N |
| XLogP | 13.05 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.83 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|