C35H26N2O3 — CID 138573332
benzenecarboximidoyl 3-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaen-18-yl)benzenecarboximidate (PubChem CID 138573332) has the molecular formula C35H26N2O3 and a molecular weight of 522.60 g/mol. Its IUPAC name is benzenecarboximidoyl 3-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaen-18-yl)benzenecarboximidate.
| Compound Name | benzenecarboximidoyl 3-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaen-18-yl)benzenecarboximidate |
|---|---|
| PubChem CID | 138573332 |
| Molecular Formula | C35H26N2O3 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | benzenecarboximidoyl 3-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaen-18-yl)benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccccc1)c1cccc(-c2ccc3c(c2)Oc2cc4c(cc2O3)C(C)(C)c2ccccc2-4)c1 |
| InChI | InChI=1S/C35H26N2O3/c1-35(2)27-14-7-6-13-25(27)26-19-31-32(20-28(26)35)38-29-16-15-23(18-30(29)39-31)22-11-8-12-24(17-22)34(37)40-33(36)21-9-4-3-5-10-21/h3-20,36-37H,1-2H3/b36-33+,37-34- |
| InChIKey | SCISABXLPDRKDT-KRIGZLOOSA-N |
| XLogP | 8.93 |
| TPSA | 75.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|