C40H34N2S — CID 166908636
(Z)-1-phenyl-4-[3-(3-spiro[cyclohexane-1,9'-thioxanthene]-2'-ylphenyl)phenyl]but-2-ene-1,4-diimine (PubChem CID 166908636) has the molecular formula C40H34N2S and a molecular weight of 574.79 g/mol. Its IUPAC name is (Z)-1-phenyl-4-[3-(3-spiro[cyclohexane-1,9'-thioxanthene]-2'-ylphenyl)phenyl]but-2-ene-1,4-diimine.
| Compound Name | (Z)-1-phenyl-4-[3-(3-spiro[cyclohexane-1,9'-thioxanthene]-2'-ylphenyl)phenyl]but-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 166908636 |
| Molecular Formula | C40H34N2S |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | (Z)-1-phenyl-4-[3-(3-spiro[cyclohexane-1,9'-thioxanthene]-2'-ylphenyl)phenyl]but-2-ene-1,4-diimine |
| SMILES | [H]/N=C(/C=C\C(=N\[H])c1cccc(-c2cccc(-c3ccc4c(c3)C3(CCCCC3)c3ccccc3S4)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C40H34N2S/c41-36(28-11-3-1-4-12-28)20-21-37(42)33-16-10-15-31(26-33)29-13-9-14-30(25-29)32-19-22-39-35(27-32)40(23-7-2-8-24-40)34-17-5-6-18-38(34)43-39/h1,3-6,9-22,25-27,41-42H,2,7-8,23-24H2/b21-20-,41-36-,42-37- |
| InChIKey | NWMOPDXMWFPMGC-CVRYSJJNSA-N |
| XLogP | 10.73 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|