spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid

C29H19BO2 — CID 140780247

IUPACspiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid
SMILESOB(O)c1ccc2c(c1)-c1cccc3cccc(c13)C21c2ccccc2-c2ccccc21
InChIInChI=1S/C29H19BO2/c31-30(32)19-15-16-26-23(17-19)22-11-5-7-18-8-6-14-27(28(18)22)29(26)24-12-3-1-9-20(24)21-10-2-4-13-25(21)29/h1-17,31-32H
InChIKeyJDQNRRLHSGDUKR-UHFFFAOYSA-N
MW410.28 g/mol
LogP4.86
Rot. Bonds1

About spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid

spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid (PubChem CID 140780247) has the molecular formula C29H19BO2 and a molecular weight of 410.28 g/mol. Its IUPAC name is spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid.

Molecular Properties

Compound Namespiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid
PubChem CID140780247
Molecular FormulaC29H19BO2
Molecular Weight410.28 g/mol
Exact Mass410.15
IUPAC Namespiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid
SMILESOB(O)c1ccc2c(c1)-c1cccc3cccc(c13)C21c2ccccc2-c2ccccc21
InChIInChI=1S/C29H19BO2/c31-30(32)19-15-16-26-23(17-19)22-11-5-7-18-8-6-14-27(28(18)22)29(26)24-12-3-1-9-20(24)21-10-2-4-13-25(21)29/h1-17,31-32H
InChIKeyJDQNRRLHSGDUKR-UHFFFAOYSA-N
XLogP4.86
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms32
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500410.28
LogP ≤ 54.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid?
The IUPAC name of spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid (CID 140780247) is spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid.
What is the SMILES notation for spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid?
The canonical SMILES for spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid is OB(O)c1ccc2c(c1)-c1cccc3cccc(c13)C21c2ccccc2-c2ccccc21.
What is the InChIKey of spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid?
The InChIKey is JDQNRRLHSGDUKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H19BO2/c31-30(32)19-15-16-26-23(17-19)22-11-5-7-18-8-6-14-27(28(18)22)29(26)24-12-3-1-9-20(24)21-10-2-4-13-25(21)29/h1-17,31-32H.
What are the key properties of spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid?
spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid has a molecular weight of 410.28 g/mol, XLogP of 4.86, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[benzo[a]phenalene-7,9'-fluorene]-10-ylboronic acid is sourced from PubChem (CID 140780247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).