C38H52N3S+ — CID 159061364
5-[9-(6,6-dimethylheptyl)-2-methyl-7-(7-methyl-2,1,3-benzothiadiazol-4-yl)fluoren-9-yl]pentyl-trimethylazanium (PubChem CID 159061364) has the molecular formula C38H52N3S+ and a molecular weight of 582.92 g/mol. Its IUPAC name is 5-[9-(6,6-dimethylheptyl)-2-methyl-7-(7-methyl-2,1,3-benzothiadiazol-4-yl)fluoren-9-yl]pentyl-trimethylazanium.
| Compound Name | 5-[9-(6,6-dimethylheptyl)-2-methyl-7-(7-methyl-2,1,3-benzothiadiazol-4-yl)fluoren-9-yl]pentyl-trimethylazanium |
|---|---|
| PubChem CID | 159061364 |
| Molecular Formula | C38H52N3S+ |
| Molecular Weight | 582.92 g/mol |
| Exact Mass | 582.39 |
| IUPAC Name | 5-[9-(6,6-dimethylheptyl)-2-methyl-7-(7-methyl-2,1,3-benzothiadiazol-4-yl)fluoren-9-yl]pentyl-trimethylazanium |
| SMILES | Cc1ccc2c(c1)C(CCCCCC(C)(C)C)(CCCCC[N+](C)(C)C)c1cc(-c3ccc(C)c4nsnc34)ccc1-2 |
| InChI | InChI=1S/C38H52N3S/c1-27-15-18-31-32-20-17-29(30-19-16-28(2)35-36(30)40-42-39-35)26-34(32)38(33(31)25-27,22-12-9-11-21-37(3,4)5)23-13-10-14-24-41(6,7)8/h15-20,25-26H,9-14,21-24H2,1-8H3/q+1 |
| InChIKey | KVJACEVPOVLJKI-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.92 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|