C41H48Br2 — CID 86093242
2,7-bis(4-bromophenyl)-9,9-bis(2-ethylhexyl)fluorene (PubChem CID 86093242) has the molecular formula C41H48Br2 and a molecular weight of 700.64 g/mol. Its IUPAC name is 2,7-bis(4-bromophenyl)-9,9-bis(2-ethylhexyl)fluorene.
| Compound Name | 2,7-bis(4-bromophenyl)-9,9-bis(2-ethylhexyl)fluorene |
|---|---|
| PubChem CID | 86093242 |
| Molecular Formula | C41H48Br2 |
| Molecular Weight | 700.64 g/mol |
| Exact Mass | 698.21 |
| IUPAC Name | 2,7-bis(4-bromophenyl)-9,9-bis(2-ethylhexyl)fluorene |
| SMILES | CCCCC(CC)CC1(CC(CC)CCCC)c2cc(-c3ccc(Br)cc3)ccc2-c2ccc(-c3ccc(Br)cc3)cc21 |
| InChI | InChI=1S/C41H48Br2/c1-5-9-11-29(7-3)27-41(28-30(8-4)12-10-6-2)39-25-33(31-13-19-35(42)20-14-31)17-23-37(39)38-24-18-34(26-40(38)41)32-15-21-36(43)22-16-32/h13-26,29-30H,5-12,27-28H2,1-4H3 |
| InChIKey | ODARIOHKNFEZMC-UHFFFAOYSA-N |
| XLogP | 14.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.64 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |